C18H15NO2 — CID 68827913
2-(13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaen-4-yl)ethanol (PubChem CID 68827913) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaen-4-yl)ethanol.
| Compound Name | 2-(13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaen-4-yl)ethanol |
|---|---|
| PubChem CID | 68827913 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-(13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2,5,7,9,11,14,16-octaen-4-yl)ethanol |
| SMILES | OCCn1cc2c(c1)-c1ccccc1Oc1ccccc1-2 |
| InChI | InChI=1S/C18H15NO2/c20-10-9-19-11-15-13-5-1-3-7-17(13)21-18-8-4-2-6-14(18)16(15)12-19/h1-8,11-12,20H,9-10H2 |
| InChIKey | IVGPRHLYLHKDRU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |