C23H17F3N2O6S — CID 68828290
2-[2-[2-[(5-cyano-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid (PubChem CID 68828290) has the molecular formula C23H17F3N2O6S and a molecular weight of 506.46 g/mol. Its IUPAC name is 2-[2-[2-[(5-cyano-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid.
| Compound Name | 2-[2-[2-[(5-cyano-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 68828290 |
| Molecular Formula | C23H17F3N2O6S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-[2-[2-[(5-cyano-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid |
| SMILES | N#Cc1ccc(O)c(S(=O)(=O)NCCc2ccc(-c3cc(F)c(F)c(F)c3)cc2OCC(=O)O)c1 |
| InChI | InChI=1S/C23H17F3N2O6S/c24-17-8-16(9-18(25)23(17)26)15-3-2-14(20(10-15)34-12-22(30)31)5-6-28-35(32,33)21-7-13(11-27)1-4-19(21)29/h1-4,7-10,28-29H,5-6,12H2,(H,30,31) |
| InChIKey | ZNQPJPFPLLJMLW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|