About 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid
2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid (PubChem CID 68828485) has the molecular formula C19H15ClFN5O4
and a molecular weight of 431.81 g/mol. Its IUPAC name is 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid |
| PubChem CID | 68828485 |
| Molecular Formula | C19H15ClFN5O4 |
| Molecular Weight | 431.81 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid |
| SMILES | Cn1c(=O)c2c(nc(-c3cccn3C(=O)O)n2Cc2c(F)cccc2Cl)n(C)c1=O |
| InChI | InChI=1S/C19H15ClFN5O4/c1-23-16-14(17(27)24(2)18(23)28)26(9-10-11(20)5-3-6-12(10)21)15(22-16)13-7-4-8-25(13)19(29)30/h3-8H,9H2,1-2H3,(H,29,30) |
| InChIKey | AVUSNIQZRFQZAU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid?
The IUPAC name of 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid (CID 68828485) is 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid.
What is the SMILES notation for 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid?
The canonical SMILES for 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid is Cn1c(=O)c2c(nc(-c3cccn3C(=O)O)n2Cc2c(F)cccc2Cl)n(C)c1=O.
What is the InChIKey of 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid?
The InChIKey is AVUSNIQZRFQZAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClFN5O4/c1-23-16-14(17(27)24(2)18(23)28)26(9-10-11(20)5-3-6-12(10)21)15(22-16)13-7-4-8-25(13)19(29)30/h3-8H,9H2,1-2H3,(H,29,30).
What are the key properties of 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid?
2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid has a molecular weight of 431.81 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-[(2-chloro-6-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]pyrrole-1-carboxylic acid is sourced from PubChem (CID 68828485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).