About 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine
3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 68828873) has the molecular formula C12H14ClN
and a molecular weight of 207.70 g/mol. Its IUPAC name is 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 68828873 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C=CCNC1CC(Cl)c2ccccc21 |
| InChI | InChI=1S/C12H14ClN/c1-2-7-14-12-8-11(13)9-5-3-4-6-10(9)12/h2-6,11-12,14H,1,7-8H2 |
| InChIKey | FHRREZCXJJVWTH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine (CID 68828873) is 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine is C=CCNC1CC(Cl)c2ccccc21.
What is the InChIKey of 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is FHRREZCXJJVWTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN/c1-2-7-14-12-8-11(13)9-5-3-4-6-10(9)12/h2-6,11-12,14H,1,7-8H2.
What are the key properties of 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine?
3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 207.70 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 68828873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).