C11H14N2 — CID 68828942
7,11-diazatricyclo[7.3.1.02,7]trideca-3,5,8-triene (PubChem CID 68828942) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 7,11-diazatricyclo[7.3.1.02,7]trideca-3,5,8-triene.
| Compound Name | 7,11-diazatricyclo[7.3.1.02,7]trideca-3,5,8-triene |
|---|---|
| PubChem CID | 68828942 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 7,11-diazatricyclo[7.3.1.02,7]trideca-3,5,8-triene |
| SMILES | C1=CC2C3CNCC(=CN2C=C1)C3 |
| InChI | InChI=1S/C11H14N2/c1-2-4-13-8-9-5-10(7-12-6-9)11(13)3-1/h1-4,8,10-12H,5-7H2 |
| InChIKey | ZNLSNFNDOQWHLS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |