C24H20BrF4N5O — CID 68828952
4-bromo-1-pentyl-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrazole-3-carbonitrile (PubChem CID 68828952) has the molecular formula C24H20BrF4N5O and a molecular weight of 550.35 g/mol. Its IUPAC name is 4-bromo-1-pentyl-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrazole-3-carbonitrile.
| Compound Name | 4-bromo-1-pentyl-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 68828952 |
| Molecular Formula | C24H20BrF4N5O |
| Molecular Weight | 550.35 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | 4-bromo-1-pentyl-5-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrazole-3-carbonitrile |
| SMILES | CCCCCn1nc(C#N)c(Br)c1C(O)(c1ccc2c(cnn2-c2ccc(F)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C24H20BrF4N5O/c1-2-3-4-11-33-22(21(25)19(13-30)32-33)23(35,24(27,28)29)16-5-10-20-15(12-16)14-31-34(20)18-8-6-17(26)7-9-18/h5-10,12,14,35H,2-4,11H2,1H3 |
| InChIKey | OSQQWTZXJHVVRX-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.35 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|