C28H39N3O4 — CID 68829231
[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-pyridin-2-yl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl] N-[2-(dimethylamino)ethyl]-N-methylcarbamate (PubChem CID 68829231) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is [(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-pyridin-2-yl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl] N-[2-(dimethylamino)ethyl]-N-methylcarbamate.
| Compound Name | [(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-pyridin-2-yl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl] N-[2-(dimethylamino)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 68829231 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | [(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-pyridin-2-yl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl] N-[2-(dimethylamino)ethyl]-N-methylcarbamate |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccn3)C[C@H]1CCc1cc(OC(=O)N(C)CCN(C)C)ccc12 |
| InChI | InChI=1S/C28H39N3O4/c1-6-27-19-26(2,33)28(34,24-9-7-8-14-29-24)18-21(27)11-10-20-17-22(12-13-23(20)27)35-25(32)31(5)16-15-30(3)4/h7-9,12-14,17,21,33-34H,6,10-11,15-16,18-19H2,1-5H3/t21-,26-,27-,28-/m1/s1 |
| InChIKey | COYUTXXDYINHMO-WWAFRDAFSA-N |
| XLogP | 3.72 |
| TPSA | 86.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |