C23H26BNO — CID 68829390
4-methyl-2-phenyl-7-(4,4,5,5-tetramethyloxaborolan-2-yl)quinoline (PubChem CID 68829390) has the molecular formula C23H26BNO and a molecular weight of 343.28 g/mol. Its IUPAC name is 4-methyl-2-phenyl-7-(4,4,5,5-tetramethyloxaborolan-2-yl)quinoline.
| Compound Name | 4-methyl-2-phenyl-7-(4,4,5,5-tetramethyloxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 68829390 |
| Molecular Formula | C23H26BNO |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-methyl-2-phenyl-7-(4,4,5,5-tetramethyloxaborolan-2-yl)quinoline |
| SMILES | Cc1cc(-c2ccccc2)nc2cc(B3CC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C23H26BNO/c1-16-13-20(17-9-7-6-8-10-17)25-21-14-18(11-12-19(16)21)24-15-22(2,3)23(4,5)26-24/h6-14H,15H2,1-5H3 |
| InChIKey | WAPQMMKLIHGLQF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|