About 2-ethenyl-4-ethyl-1,3-oxazolidine
2-ethenyl-4-ethyl-1,3-oxazolidine (PubChem CID 68829416) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 2-ethenyl-4-ethyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-ethenyl-4-ethyl-1,3-oxazolidine |
| PubChem CID | 68829416 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 2-ethenyl-4-ethyl-1,3-oxazolidine |
| SMILES | C=CC1NC(CC)CO1 |
| InChI | InChI=1S/C7H13NO/c1-3-6-5-9-7(4-2)8-6/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | MKEQIUDSTZUBJR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-4-ethyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4-ethyl-1,3-oxazolidine?
The IUPAC name of 2-ethenyl-4-ethyl-1,3-oxazolidine (CID 68829416) is 2-ethenyl-4-ethyl-1,3-oxazolidine.
What is the SMILES notation for 2-ethenyl-4-ethyl-1,3-oxazolidine?
The canonical SMILES for 2-ethenyl-4-ethyl-1,3-oxazolidine is C=CC1NC(CC)CO1.
What is the InChIKey of 2-ethenyl-4-ethyl-1,3-oxazolidine?
The InChIKey is MKEQIUDSTZUBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-3-6-5-9-7(4-2)8-6/h4,6-8H,2-3,5H2,1H3.
What are the key properties of 2-ethenyl-4-ethyl-1,3-oxazolidine?
2-ethenyl-4-ethyl-1,3-oxazolidine has a molecular weight of 127.19 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4-ethyl-1,3-oxazolidine is sourced from PubChem (CID 68829416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).