About acetamide;1H-imidazo[4,5-b]pyridine
acetamide;1H-imidazo[4,5-b]pyridine (PubChem CID 68829482) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is acetamide;1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | acetamide;1H-imidazo[4,5-b]pyridine |
| PubChem CID | 68829482 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | acetamide;1H-imidazo[4,5-b]pyridine |
| SMILES | CC(N)=O.c1cnc2nc[nH]c2c1 |
| InChI | InChI=1S/C6H5N3.C2H5NO/c1-2-5-6(7-3-1)9-4-8-5;1-2(3)4/h1-4H,(H,7,8,9);1H3,(H2,3,4) |
| InChIKey | OMQSKHGVOONBEF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetamide;1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;1H-imidazo[4,5-b]pyridine?
The IUPAC name of acetamide;1H-imidazo[4,5-b]pyridine (CID 68829482) is acetamide;1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for acetamide;1H-imidazo[4,5-b]pyridine?
The canonical SMILES for acetamide;1H-imidazo[4,5-b]pyridine is CC(N)=O.c1cnc2nc[nH]c2c1.
What is the InChIKey of acetamide;1H-imidazo[4,5-b]pyridine?
The InChIKey is OMQSKHGVOONBEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.C2H5NO/c1-2-5-6(7-3-1)9-4-8-5;1-2(3)4/h1-4H,(H,7,8,9);1H3,(H2,3,4).
What are the key properties of acetamide;1H-imidazo[4,5-b]pyridine?
acetamide;1H-imidazo[4,5-b]pyridine has a molecular weight of 178.19 g/mol, XLogP of 0.45, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 68829482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).