C20H17FN4O4 — CID 6882952
8-fluoro-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 6882952) has the molecular formula C20H17FN4O4 and a molecular weight of 396.38 g/mol. Its IUPAC name is 8-fluoro-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 8-fluoro-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 6882952 |
| Molecular Formula | C20H17FN4O4 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 8-fluoro-3-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | COc1cc(/C=N/n2cnc3c([nH]c4ccc(F)cc43)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H17FN4O4/c1-27-15-6-11(7-16(28-2)19(15)29-3)9-23-25-10-22-17-13-8-12(21)4-5-14(13)24-18(17)20(25)26/h4-10,24H,1-3H3/b23-9+ |
| InChIKey | GUEURFOPLQGGFT-NUGSKGIGSA-N |
| XLogP | 2.92 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|