C29H39N3O4 — CID 68829575
[(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-pyridin-2-yl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl] N-(2-pyrrolidin-1-ylethyl)carbamate (PubChem CID 68829575) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is [(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-pyridin-2-yl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl] N-(2-pyrrolidin-1-ylethyl)carbamate.
| Compound Name | [(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-pyridin-2-yl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl] N-(2-pyrrolidin-1-ylethyl)carbamate |
|---|---|
| PubChem CID | 68829575 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | [(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-6-methyl-7-pyridin-2-yl-8,8a,9,10-tetrahydro-5H-phenanthren-2-yl] N-(2-pyrrolidin-1-ylethyl)carbamate |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccn3)C[C@H]1CCc1cc(OC(=O)NCCN3CCCC3)ccc12 |
| InChI | InChI=1S/C29H39N3O4/c1-3-28-20-27(2,34)29(35,25-8-4-5-13-30-25)19-22(28)10-9-21-18-23(11-12-24(21)28)36-26(33)31-14-17-32-15-6-7-16-32/h4-5,8,11-13,18,22,34-35H,3,6-7,9-10,14-17,19-20H2,1-2H3,(H,31,33)/t22-,27-,28-,29-/m1/s1 |
| InChIKey | LLWHUDYPFROTFV-KMLOMXCPSA-N |
| XLogP | 3.91 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |