About 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid
3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid (PubChem CID 68829756) has the molecular formula C28H25NO3
and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid |
| PubChem CID | 68829756 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(OC2Cc3ccccc3C2)c(-c2ccc3cnccc3c2)c1)C(=O)O |
| InChI | InChI=1S/C28H25NO3/c1-18(28(30)31)12-19-6-9-27(32-25-15-20-4-2-3-5-21(20)16-25)26(13-19)23-7-8-24-17-29-11-10-22(24)14-23/h2-11,13-14,17-18,25H,12,15-16H2,1H3,(H,30,31) |
| InChIKey | KMADFONWYDGBKZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid?
The IUPAC name of 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid (CID 68829756) is 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid.
What is the SMILES notation for 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid?
The canonical SMILES for 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid is CC(Cc1ccc(OC2Cc3ccccc3C2)c(-c2ccc3cnccc3c2)c1)C(=O)O.
What is the InChIKey of 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid?
The InChIKey is KMADFONWYDGBKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25NO3/c1-18(28(30)31)12-19-6-9-27(32-25-15-20-4-2-3-5-21(20)16-25)26(13-19)23-7-8-24-17-29-11-10-22(24)14-23/h2-11,13-14,17-18,25H,12,15-16H2,1H3,(H,30,31).
What are the key properties of 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid?
3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid has a molecular weight of 423.51 g/mol, XLogP of 5.71, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-isoquinolin-6-ylphenyl]-2-methylpropanoic acid is sourced from PubChem (CID 68829756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).