About 3-bromo-2,4,6-trimethylaniline
3-bromo-2,4,6-trimethylaniline (PubChem CID 688300) has the molecular formula C9H12BrN
and a molecular weight of 214.11 g/mol. Its IUPAC name is 3-bromo-2,4,6-trimethylaniline.
Molecular Properties
| Compound Name | 3-bromo-2,4,6-trimethylaniline |
| PubChem CID | 688300 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 3-bromo-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(Br)c(C)c1N |
| InChI | InChI=1S/C9H12BrN/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,11H2,1-3H3 |
| InChIKey | MVLMPTBHZPYDBZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4,6-trimethylaniline?
The IUPAC name of 3-bromo-2,4,6-trimethylaniline (CID 688300) is 3-bromo-2,4,6-trimethylaniline.
What is the SMILES notation for 3-bromo-2,4,6-trimethylaniline?
The canonical SMILES for 3-bromo-2,4,6-trimethylaniline is Cc1cc(C)c(Br)c(C)c1N.
What is the InChIKey of 3-bromo-2,4,6-trimethylaniline?
The InChIKey is MVLMPTBHZPYDBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,11H2,1-3H3.
What are the key properties of 3-bromo-2,4,6-trimethylaniline?
3-bromo-2,4,6-trimethylaniline has a molecular weight of 214.11 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4,6-trimethylaniline is sourced from PubChem (CID 688300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).