C24H18F2N4O3 — CID 68830385
[[3-amino-2-(2,6-difluorophenyl)quinoline-4-carbonyl]-methylamino]-phenylcarbamic acid (PubChem CID 68830385) has the molecular formula C24H18F2N4O3 and a molecular weight of 448.43 g/mol. Its IUPAC name is [[3-amino-2-(2,6-difluorophenyl)quinoline-4-carbonyl]-methylamino]-phenylcarbamic acid.
| Compound Name | [[3-amino-2-(2,6-difluorophenyl)quinoline-4-carbonyl]-methylamino]-phenylcarbamic acid |
|---|---|
| PubChem CID | 68830385 |
| Molecular Formula | C24H18F2N4O3 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [[3-amino-2-(2,6-difluorophenyl)quinoline-4-carbonyl]-methylamino]-phenylcarbamic acid |
| SMILES | CN(C(=O)c1c(N)c(-c2c(F)cccc2F)nc2ccccc12)N(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H18F2N4O3/c1-29(30(24(32)33)14-8-3-2-4-9-14)23(31)19-15-10-5-6-13-18(15)28-22(21(19)27)20-16(25)11-7-12-17(20)26/h2-13H,27H2,1H3,(H,32,33) |
| InChIKey | UZCKUCRXLZYXAU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|