About 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione
1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione (PubChem CID 68830514) has the molecular formula C27H26Cl2N2O2
and a molecular weight of 481.42 g/mol. Its IUPAC name is 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione.
Molecular Properties
| Compound Name | 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione |
| PubChem CID | 68830514 |
| Molecular Formula | C27H26Cl2N2O2 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione |
| SMILES | CCN(CC)c1ccc(C2(C)C(=O)c3c(Cl)cc(Cl)cc3N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H26Cl2N2O2/c1-4-30(5-2)21-13-11-19(12-14-21)27(3)25(32)24-22(29)15-20(28)16-23(24)31(26(27)33)17-18-9-7-6-8-10-18/h6-16H,4-5,17H2,1-3H3 |
| InChIKey | GMGZTDROSZRCCY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione?
The IUPAC name of 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione (CID 68830514) is 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione.
What is the SMILES notation for 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione?
The canonical SMILES for 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione is CCN(CC)c1ccc(C2(C)C(=O)c3c(Cl)cc(Cl)cc3N(Cc3ccccc3)C2=O)cc1.
What is the InChIKey of 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione?
The InChIKey is GMGZTDROSZRCCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26Cl2N2O2/c1-4-30(5-2)21-13-11-19(12-14-21)27(3)25(32)24-22(29)15-20(28)16-23(24)31(26(27)33)17-18-9-7-6-8-10-18/h6-16H,4-5,17H2,1-3H3.
What are the key properties of 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione?
1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione has a molecular weight of 481.42 g/mol, XLogP of 6.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5,7-dichloro-3-[4-(diethylamino)phenyl]-3-methylquinoline-2,4-dione is sourced from PubChem (CID 68830514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).