C22H23N3O5 — CID 68830938
(3S)-3-[[(5S)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazole-5-carbonyl]amino]-4-oxohex-5-enoic acid (PubChem CID 68830938) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is (3S)-3-[[(5S)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazole-5-carbonyl]amino]-4-oxohex-5-enoic acid.
| Compound Name | (3S)-3-[[(5S)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazole-5-carbonyl]amino]-4-oxohex-5-enoic acid |
|---|---|
| PubChem CID | 68830938 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (3S)-3-[[(5S)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazole-5-carbonyl]amino]-4-oxohex-5-enoic acid |
| SMILES | C=CC(=O)[C@H](CC(=O)O)NC(=O)[C@@]1(C(C)C)CC(c2nccc3ccccc23)=NO1 |
| InChI | InChI=1S/C22H23N3O5/c1-4-18(26)16(11-19(27)28)24-21(29)22(13(2)3)12-17(25-30-22)20-15-8-6-5-7-14(15)9-10-23-20/h4-10,13,16H,1,11-12H2,2-3H3,(H,24,29)(H,27,28)/t16-,22-/m0/s1 |
| InChIKey | OUQYLKJBLUICRD-AOMKIAJQSA-N |
| XLogP | 2.47 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|