C27H37NO2Si — CID 68832050
(2S,4aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-4a-ethyl-2-pyridin-3-yl-1,9,10,10a-tetrahydrophenanthren-2-ol (PubChem CID 68832050) has the molecular formula C27H37NO2Si and a molecular weight of 435.68 g/mol. Its IUPAC name is (2S,4aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-4a-ethyl-2-pyridin-3-yl-1,9,10,10a-tetrahydrophenanthren-2-ol.
| Compound Name | (2S,4aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-4a-ethyl-2-pyridin-3-yl-1,9,10,10a-tetrahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 68832050 |
| Molecular Formula | C27H37NO2Si |
| Molecular Weight | 435.68 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | (2S,4aR,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-4a-ethyl-2-pyridin-3-yl-1,9,10,10a-tetrahydrophenanthren-2-ol |
| SMILES | CC[C@]12C=C[C@](O)(c3cccnc3)C[C@H]1CCc1cc(O[Si](C)(C)C(C)(C)C)ccc12 |
| InChI | InChI=1S/C27H37NO2Si/c1-7-26-14-15-27(29,22-9-8-16-28-19-22)18-21(26)11-10-20-17-23(12-13-24(20)26)30-31(5,6)25(2,3)4/h8-9,12-17,19,21,29H,7,10-11,18H2,1-6H3/t21-,26+,27-/m1/s1 |
| InChIKey | CZJBVARNEAIVRI-COFKYPDJSA-N |
| XLogP | 6.52 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|