C25H31ClN4O4 — CID 68832139
1-[2-[2-(chloromethyl)pyrrolidin-1-yl]ethylamino]-4-[1-(dimethylamino)ethylamino]-5,8-dihydroxyanthracene-9,10-dione (PubChem CID 68832139) has the molecular formula C25H31ClN4O4 and a molecular weight of 487.00 g/mol. Its IUPAC name is 1-[2-[2-(chloromethyl)pyrrolidin-1-yl]ethylamino]-4-[1-(dimethylamino)ethylamino]-5,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 1-[2-[2-(chloromethyl)pyrrolidin-1-yl]ethylamino]-4-[1-(dimethylamino)ethylamino]-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 68832139 |
| Molecular Formula | C25H31ClN4O4 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1-[2-[2-(chloromethyl)pyrrolidin-1-yl]ethylamino]-4-[1-(dimethylamino)ethylamino]-5,8-dihydroxyanthracene-9,10-dione |
| SMILES | CC(Nc1ccc(NCCN2CCCC2CCl)c2c1C(=O)c1c(O)ccc(O)c1C2=O)N(C)C |
| InChI | InChI=1S/C25H31ClN4O4/c1-14(29(2)3)28-17-7-6-16(27-10-12-30-11-4-5-15(30)13-26)20-21(17)25(34)23-19(32)9-8-18(31)22(23)24(20)33/h6-9,14-15,27-28,31-32H,4-5,10-13H2,1-3H3 |
| InChIKey | NVCVAHFHTAHGBC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|