About (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid
(6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid (PubChem CID 68832498) has the molecular formula C13H11ClFNO2
and a molecular weight of 267.69 g/mol. Its IUPAC name is (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid.
Molecular Properties
| Compound Name | (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid |
| PubChem CID | 68832498 |
| Molecular Formula | C13H11ClFNO2 |
| Molecular Weight | 267.69 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid |
| SMILES | O=C(O)NC1C(c2ccccc2)=CC=CC1(F)Cl |
| InChI | InChI=1S/C13H11ClFNO2/c14-13(15)8-4-7-10(11(13)16-12(17)18)9-5-2-1-3-6-9/h1-8,11,16H,(H,17,18) |
| InChIKey | NJCQPQOIGVSFIR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.69 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid?
The IUPAC name of (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid (CID 68832498) is (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid.
What is the SMILES notation for (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid?
The canonical SMILES for (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid is O=C(O)NC1C(c2ccccc2)=CC=CC1(F)Cl.
What is the InChIKey of (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid?
The InChIKey is NJCQPQOIGVSFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClFNO2/c14-13(15)8-4-7-10(11(13)16-12(17)18)9-5-2-1-3-6-9/h1-8,11,16H,(H,17,18).
What are the key properties of (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid?
(6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid has a molecular weight of 267.69 g/mol, XLogP of 3.18, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-6-fluoro-2-phenylcyclohexa-2,4-dien-1-yl)carbamic acid is sourced from PubChem (CID 68832498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).