C15H14N2O3S — CID 6883293
N-[(E)-(3-methylthiophen-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 6883293) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-[(E)-(3-methylthiophen-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[(E)-(3-methylthiophen-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 6883293 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-[(E)-(3-methylthiophen-2-yl)methylideneamino]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | Cc1ccsc1/C=N/NC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H14N2O3S/c1-10-4-7-21-14(10)9-16-17-15(18)11-2-3-12-13(8-11)20-6-5-19-12/h2-4,7-9H,5-6H2,1H3,(H,17,18)/b16-9+ |
| InChIKey | TXKZEVWJSFXKFZ-CXUHLZMHSA-N |
| XLogP | 2.59 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|