C19H22IN — CID 68832953
(10E)-10-benzylidene-1-methyl-6,7,8,9-tetrahydro-5H-cycloocta[b]pyridin-1-ium iodide (PubChem CID 68832953) has the molecular formula C19H22IN and a molecular weight of 391.30 g/mol. Its IUPAC name is (10E)-10-benzylidene-1-methyl-6,7,8,9-tetrahydro-5H-cycloocta[b]pyridin-1-ium iodide.
| Compound Name | (10E)-10-benzylidene-1-methyl-6,7,8,9-tetrahydro-5H-cycloocta[b]pyridin-1-ium iodide |
|---|---|
| PubChem CID | 68832953 |
| Molecular Formula | C19H22IN |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (10E)-10-benzylidene-1-methyl-6,7,8,9-tetrahydro-5H-cycloocta[b]pyridin-1-ium iodide |
| SMILES | C[n+]1cccc2c1/C(=C/c1ccccc1)CCCCC2.[I-] |
| InChI | InChI=1S/C19H22N.HI/c1-20-14-8-13-17-11-6-3-7-12-18(19(17)20)15-16-9-4-2-5-10-16;/h2,4-5,8-10,13-15H,3,6-7,11-12H2,1H3;1H/q+1;/p-1/b18-15+; |
| InChIKey | PJCVADYZEUOMST-FLNCGGNMSA-M |
| XLogP | 1.17 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|