C13H15N5O3S — CID 6883299
5-tert-butyl-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1H-pyrazole-3-carboxamide (PubChem CID 6883299) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 5-tert-butyl-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6883299 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 5-tert-butyl-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)N/N=C/c2ccc([N+](=O)[O-])s2)n[nH]1 |
| InChI | InChI=1S/C13H15N5O3S/c1-13(2,3)10-6-9(15-16-10)12(19)17-14-7-8-4-5-11(22-8)18(20)21/h4-7H,1-3H3,(H,15,16)(H,17,19)/b14-7+ |
| InChIKey | TZKXXUQEUSIOGI-VGOFMYFVSA-N |
| XLogP | 2.44 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|