About 2-ethyl-1H-pyridine-2,5-diamine
2-ethyl-1H-pyridine-2,5-diamine (PubChem CID 68833078) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-ethyl-1H-pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 2-ethyl-1H-pyridine-2,5-diamine |
| PubChem CID | 68833078 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2-ethyl-1H-pyridine-2,5-diamine |
| SMILES | CCC1(N)C=CC(N)=CN1 |
| InChI | InChI=1S/C7H13N3/c1-2-7(9)4-3-6(8)5-10-7/h3-5,10H,2,8-9H2,1H3 |
| InChIKey | YTUTZRKPFRPZNF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1H-pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1H-pyridine-2,5-diamine?
The IUPAC name of 2-ethyl-1H-pyridine-2,5-diamine (CID 68833078) is 2-ethyl-1H-pyridine-2,5-diamine.
What is the SMILES notation for 2-ethyl-1H-pyridine-2,5-diamine?
The canonical SMILES for 2-ethyl-1H-pyridine-2,5-diamine is CCC1(N)C=CC(N)=CN1.
What is the InChIKey of 2-ethyl-1H-pyridine-2,5-diamine?
The InChIKey is YTUTZRKPFRPZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-2-7(9)4-3-6(8)5-10-7/h3-5,10H,2,8-9H2,1H3.
What are the key properties of 2-ethyl-1H-pyridine-2,5-diamine?
2-ethyl-1H-pyridine-2,5-diamine has a molecular weight of 139.20 g/mol, XLogP of 0.01, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1H-pyridine-2,5-diamine is sourced from PubChem (CID 68833078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).