C29H38O6 — CID 68833129
(5R,11R,13S,17S)-11-[4-(1,3-dioxolan-2-yl)phenyl]-3,3-dimethoxy-13-methyl-1,2,4,6,7,8,11,12,14,17-decahydrocyclopenta[a]phenanthrene-5,17-diol (PubChem CID 68833129) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is (5R,11R,13S,17S)-11-[4-(1,3-dioxolan-2-yl)phenyl]-3,3-dimethoxy-13-methyl-1,2,4,6,7,8,11,12,14,17-decahydrocyclopenta[a]phenanthrene-5,17-diol.
| Compound Name | (5R,11R,13S,17S)-11-[4-(1,3-dioxolan-2-yl)phenyl]-3,3-dimethoxy-13-methyl-1,2,4,6,7,8,11,12,14,17-decahydrocyclopenta[a]phenanthrene-5,17-diol |
|---|---|
| PubChem CID | 68833129 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (5R,11R,13S,17S)-11-[4-(1,3-dioxolan-2-yl)phenyl]-3,3-dimethoxy-13-methyl-1,2,4,6,7,8,11,12,14,17-decahydrocyclopenta[a]phenanthrene-5,17-diol |
| SMILES | COC1(OC)CCC2=C3C(CC[C@@]2(O)C1)C1C=C[C@H](O)[C@@]1(C)C[C@@H]3c1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C29H38O6/c1-27-16-21(18-4-6-19(7-5-18)26-34-14-15-35-26)25-20(22(27)8-9-24(27)30)10-12-28(31)17-29(32-2,33-3)13-11-23(25)28/h4-9,20-22,24,26,30-31H,10-17H2,1-3H3/t20?,21-,22?,24+,27+,28-/m1/s1 |
| InChIKey | NLZQKVZJWJMMNB-CPVRHNIFSA-N |
| XLogP | 4.38 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|