About CID 68833466
CID 68833466 (PubChem CID 68833466) has the molecular formula C31H38FN3O2Si
and a molecular weight of 531.75 g/mol.
Molecular Properties
| Compound Name | CID 68833466 |
| PubChem CID | 68833466 |
| Molecular Formula | C31H38FN3O2Si |
| Molecular Weight | 531.75 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1cccc2cccc(CN3CCC4(CC3)C(=O)NCN4c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C31H38FN3O2Si/c1-29(2,3)38-37-30(4,5)26-11-7-9-22-8-6-10-23(27(22)26)20-34-18-16-31(17-19-34)28(36)33-21-35(31)25-14-12-24(32)13-15-25/h6-15H,16-21H2,1-5H3,(H,33,36) |
| InChIKey | RMYJSHIFPOVPDH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68833466 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68833466?
The IUPAC name of CID 68833466 (CID 68833466) is not available.
What is the SMILES notation for CID 68833466?
The canonical SMILES for CID 68833466 is CC(C)(C)[Si]OC(C)(C)c1cccc2cccc(CN3CCC4(CC3)C(=O)NCN4c3ccc(F)cc3)c12.
What is the InChIKey of CID 68833466?
The InChIKey is RMYJSHIFPOVPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H38FN3O2Si/c1-29(2,3)38-37-30(4,5)26-11-7-9-22-8-6-10-23(27(22)26)20-34-18-16-31(17-19-34)28(36)33-21-35(31)25-14-12-24(32)13-15-25/h6-15H,16-21H2,1-5H3,(H,33,36).
What are the key properties of CID 68833466?
CID 68833466 has a molecular weight of 531.75 g/mol, XLogP of 6.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68833466 is sourced from PubChem (CID 68833466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).