About pyrimidine-2,4-dicarboxamide
pyrimidine-2,4-dicarboxamide (PubChem CID 68833476) has the molecular formula C6H6N4O2
and a molecular weight of 166.14 g/mol. Its IUPAC name is pyrimidine-2,4-dicarboxamide.
Molecular Properties
| Compound Name | pyrimidine-2,4-dicarboxamide |
| PubChem CID | 68833476 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | pyrimidine-2,4-dicarboxamide |
| SMILES | NC(=O)c1ccnc(C(N)=O)n1 |
| InChI | InChI=1S/C6H6N4O2/c7-4(11)3-1-2-9-6(10-3)5(8)12/h1-2H,(H2,7,11)(H2,8,12) |
| InChIKey | CYCHPJBNLPTBMG-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrimidine-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidine-2,4-dicarboxamide?
The IUPAC name of pyrimidine-2,4-dicarboxamide (CID 68833476) is pyrimidine-2,4-dicarboxamide.
What is the SMILES notation for pyrimidine-2,4-dicarboxamide?
The canonical SMILES for pyrimidine-2,4-dicarboxamide is NC(=O)c1ccnc(C(N)=O)n1.
What is the InChIKey of pyrimidine-2,4-dicarboxamide?
The InChIKey is CYCHPJBNLPTBMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2/c7-4(11)3-1-2-9-6(10-3)5(8)12/h1-2H,(H2,7,11)(H2,8,12).
What are the key properties of pyrimidine-2,4-dicarboxamide?
pyrimidine-2,4-dicarboxamide has a molecular weight of 166.14 g/mol, XLogP of -1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidine-2,4-dicarboxamide is sourced from PubChem (CID 68833476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).