C23H26O3 — CID 68833523
(2R,3R,4aR,10aS)-4a-ethyl-3-methyl-2-phenyl-4,10a-dihydro-1H-phenanthrene-2,3,7-triol (PubChem CID 68833523) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2R,3R,4aR,10aS)-4a-ethyl-3-methyl-2-phenyl-4,10a-dihydro-1H-phenanthrene-2,3,7-triol.
| Compound Name | (2R,3R,4aR,10aS)-4a-ethyl-3-methyl-2-phenyl-4,10a-dihydro-1H-phenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 68833523 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (2R,3R,4aR,10aS)-4a-ethyl-3-methyl-2-phenyl-4,10a-dihydro-1H-phenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccc3)C[C@H]1C=Cc1cc(O)ccc12 |
| InChI | InChI=1S/C23H26O3/c1-3-22-15-21(2,25)23(26,17-7-5-4-6-8-17)14-18(22)10-9-16-13-19(24)11-12-20(16)22/h4-13,18,24-26H,3,14-15H2,1-2H3/t18-,21-,22-,23-/m1/s1 |
| InChIKey | IRIIUDZNMALVTI-RLLPEYFOSA-N |
| XLogP | 4.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |