C25H31NO3 — CID 68833641
(4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-N,6-dimethyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide (PubChem CID 68833641) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-N,6-dimethyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide.
| Compound Name | (4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-N,6-dimethyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide |
|---|---|
| PubChem CID | 68833641 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (4bR,6R,7R,8aR)-4b-ethyl-6,7-dihydroxy-N,6-dimethyl-7-phenyl-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxamide |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccc3)C[C@H]1CCc1cc(C(=O)NC)ccc12 |
| InChI | InChI=1S/C25H31NO3/c1-4-24-16-23(2,28)25(29,19-8-6-5-7-9-19)15-20(24)12-10-17-14-18(22(27)26-3)11-13-21(17)24/h5-9,11,13-14,20,28-29H,4,10,12,15-16H2,1-3H3,(H,26,27)/t20-,23-,24-,25-/m1/s1 |
| InChIKey | HOUOYRTXDWNRTB-KMRPREKFSA-N |
| XLogP | 3.69 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |