C25H32O3 — CID 68834022
(2R,3R,4aR,10aS)-4a-ethyl-3,9,10-trimethyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol (PubChem CID 68834022) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is (2R,3R,4aR,10aS)-4a-ethyl-3,9,10-trimethyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol.
| Compound Name | (2R,3R,4aR,10aS)-4a-ethyl-3,9,10-trimethyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 68834022 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (2R,3R,4aR,10aS)-4a-ethyl-3,9,10-trimethyl-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccc3)C[C@H]1C(C)C(C)c1cc(O)ccc12 |
| InChI | InChI=1S/C25H32O3/c1-5-24-15-23(4,27)25(28,18-9-7-6-8-10-18)14-22(24)17(3)16(2)20-13-19(26)11-12-21(20)24/h6-13,16-17,22,26-28H,5,14-15H2,1-4H3/t16?,17?,22-,23+,24-,25+/m0/s1 |
| InChIKey | NYHPVGNODHZGOH-BMFCMNBHSA-N |
| XLogP | 4.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |