C30H35N3O9S2 — CID 68834613
methyl 4-methyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-5-[3-[[1-(2-nitrophenyl)sulfonylpiperidin-4-yl]amino]phenyl]thiophene-2-carboxylate (PubChem CID 68834613) has the molecular formula C30H35N3O9S2 and a molecular weight of 645.76 g/mol. Its IUPAC name is methyl 4-methyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-5-[3-[[1-(2-nitrophenyl)sulfonylpiperidin-4-yl]amino]phenyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-5-[3-[[1-(2-nitrophenyl)sulfonylpiperidin-4-yl]amino]phenyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 68834613 |
| Molecular Formula | C30H35N3O9S2 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.18 |
| IUPAC Name | methyl 4-methyl-3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-5-[3-[[1-(2-nitrophenyl)sulfonylpiperidin-4-yl]amino]phenyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2cccc(NC3CCN(S(=O)(=O)c4ccccc4[N+](=O)[O-])CC3)c2)c(C)c1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H35N3O9S2/c1-19-26(41-18-25(34)42-30(2,3)4)28(29(35)40-5)43-27(19)20-9-8-10-22(17-20)31-21-13-15-32(16-14-21)44(38,39)24-12-7-6-11-23(24)33(36)37/h6-12,17,21,31H,13-16,18H2,1-5H3 |
| InChIKey | NUGJJAOHMMDMQH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|