About N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide
N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide (PubChem CID 68835426) has the molecular formula C24H28BrN5S
and a molecular weight of 498.49 g/mol. Its IUPAC name is N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide.
Molecular Properties
| Compound Name | N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide |
| PubChem CID | 68835426 |
| Molecular Formula | C24H28BrN5S |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide |
| SMILES | CCN(CC)c1c[n+](C)c(/N=N/c2c(-c3ccccc3)n(CC)c3ccccc23)s1.[Br-] |
| InChI | InChI=1S/C24H28N5S.BrH/c1-5-28(6-2)21-17-27(4)24(30-21)26-25-22-19-15-11-12-16-20(19)29(7-3)23(22)18-13-9-8-10-14-18;/h8-17H,5-7H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XTSDDNJVZUQWON-UHFFFAOYSA-M |
| XLogP | 3.48 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide?
The IUPAC name of N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide (CID 68835426) is N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide.
What is the SMILES notation for N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide?
The canonical SMILES for N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide is CCN(CC)c1c[n+](C)c(/N=N/c2c(-c3ccccc3)n(CC)c3ccccc23)s1.[Br-].
What is the InChIKey of N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide?
The InChIKey is XTSDDNJVZUQWON-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H28N5S.BrH/c1-5-28(6-2)21-17-27(4)24(30-21)26-25-22-19-15-11-12-16-20(19)29(7-3)23(22)18-13-9-8-10-14-18;/h8-17H,5-7H2,1-4H3;1H/q+1;/p-1.
What are the key properties of N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide?
N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide has a molecular weight of 498.49 g/mol, XLogP of 3.48, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-[(1-ethyl-2-phenylindol-3-yl)diazenyl]-3-methyl-1,3-thiazol-3-ium-5-amine bromide is sourced from PubChem (CID 68835426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).