C11H15NO5 — CID 688371
(2S,3R,4R,5S)-2-(4-aminophenoxy)oxane-3,4,5-triol (PubChem CID 688371) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-(4-aminophenoxy)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-(4-aminophenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 688371 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (2S,3R,4R,5S)-2-(4-aminophenoxy)oxane-3,4,5-triol |
| SMILES | Nc1ccc(O[C@@H]2OC[C@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C11H15NO5/c12-6-1-3-7(4-2-6)17-11-10(15)9(14)8(13)5-16-11/h1-4,8-11,13-15H,5,12H2/t8-,9+,10+,11-/m0/s1 |
| InChIKey | QZFWYFWIDORFSN-ZDCRXTMVSA-N |
| XLogP | -0.91 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|