About 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol
2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol (PubChem CID 68837295) has the molecular formula C15H12Br4O2
and a molecular weight of 543.88 g/mol. Its IUPAC name is 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol.
Molecular Properties
| Compound Name | 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol |
| PubChem CID | 68837295 |
| Molecular Formula | C15H12Br4O2 |
| Molecular Weight | 543.88 g/mol |
| Exact Mass | 539.76 |
| IUPAC Name | 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol |
| SMILES | CCC(c1ccc(Br)c(Br)c1O)c1ccc(Br)c(Br)c1O |
| InChI | InChI=1S/C15H12Br4O2/c1-2-7(8-3-5-10(16)12(18)14(8)20)9-4-6-11(17)13(19)15(9)21/h3-7,20-21H,2H2,1H3 |
| InChIKey | DKWSLBALJDZLKV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.88 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol?
The IUPAC name of 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol (CID 68837295) is 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol.
What is the SMILES notation for 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol?
The canonical SMILES for 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol is CCC(c1ccc(Br)c(Br)c1O)c1ccc(Br)c(Br)c1O.
What is the InChIKey of 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol?
The InChIKey is DKWSLBALJDZLKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Br4O2/c1-2-7(8-3-5-10(16)12(18)14(8)20)9-4-6-11(17)13(19)15(9)21/h3-7,20-21H,2H2,1H3.
What are the key properties of 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol?
2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol has a molecular weight of 543.88 g/mol, XLogP of 6.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-6-[1-(3,4-dibromo-2-hydroxyphenyl)propyl]phenol is sourced from PubChem (CID 68837295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).