C25H25FN4O2 — CID 6883971
3-[(E)-[(2Z)-2-benzylideneoctylidene]amino]-8-fluoro-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 6883971) has the molecular formula C25H25FN4O2 and a molecular weight of 432.50 g/mol. Its IUPAC name is 3-[(E)-[(2Z)-2-benzylideneoctylidene]amino]-8-fluoro-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 3-[(E)-[(2Z)-2-benzylideneoctylidene]amino]-8-fluoro-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 6883971 |
| Molecular Formula | C25H25FN4O2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3-[(E)-[(2Z)-2-benzylideneoctylidene]amino]-8-fluoro-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | CCCCCCC(=C/c1ccccc1)/C=N/n1c(=O)[nH]c2c([nH]c3ccc(F)cc32)c1=O |
| InChI | InChI=1S/C25H25FN4O2/c1-2-3-4-6-11-18(14-17-9-7-5-8-10-17)16-27-30-24(31)23-22(29-25(30)32)20-15-19(26)12-13-21(20)28-23/h5,7-10,12-16,28H,2-4,6,11H2,1H3,(H,29,32)/b18-14-,27-16+ |
| InChIKey | VPINXZQWBLHRBQ-DPVRZMGRSA-N |
| XLogP | 5.20 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|