C7H5Cl3O — CID 6884
1,3,5-trichloro-2-methoxybenzene (PubChem CID 6884) has the molecular formula C7H5Cl3O and a molecular weight of 211.47 g/mol. Its IUPAC name is 1,3,5-trichloro-2-methoxybenzene.
| Compound Name | 1,3,5-trichloro-2-methoxybenzene |
|---|---|
| PubChem CID | 6884 |
| Molecular Formula | C7H5Cl3O |
| Molecular Weight | 211.47 g/mol |
| Exact Mass | 209.94 |
| IUPAC Name | 1,3,5-trichloro-2-methoxybenzene |
| SMILES | COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3 |
| InChIKey | WCVOGSZTONGSQY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |