C14H12FNO6 — CID 68840403
4-[(4-fluorophenyl)methyl]-2,6-dioxopiperidine-3,5-dicarboxylic acid (PubChem CID 68840403) has the molecular formula C14H12FNO6 and a molecular weight of 309.25 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-2,6-dioxopiperidine-3,5-dicarboxylic acid.
| Compound Name | 4-[(4-fluorophenyl)methyl]-2,6-dioxopiperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 68840403 |
| Molecular Formula | C14H12FNO6 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-2,6-dioxopiperidine-3,5-dicarboxylic acid |
| SMILES | O=C(O)C1C(=O)NC(=O)C(C(=O)O)C1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H12FNO6/c15-7-3-1-6(2-4-7)5-8-9(13(19)20)11(17)16-12(18)10(8)14(21)22/h1-4,8-10H,5H2,(H,19,20)(H,21,22)(H,16,17,18) |
| InChIKey | IGYWZKDKYLBZML-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|