About 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine
8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine (PubChem CID 68840997) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine |
| PubChem CID | 68840997 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine |
| SMILES | CCCC(CCC)c1cc(C)nn2cc(C)nc12 |
| InChI | InChI=1S/C15H23N3/c1-5-7-13(8-6-2)14-9-11(3)17-18-10-12(4)16-15(14)18/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | ATSBVCPMEOYCGN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine?
The IUPAC name of 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine (CID 68840997) is 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine?
The canonical SMILES for 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine is CCCC(CCC)c1cc(C)nn2cc(C)nc12.
What is the InChIKey of 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine?
The InChIKey is ATSBVCPMEOYCGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3/c1-5-7-13(8-6-2)14-9-11(3)17-18-10-12(4)16-15(14)18/h9-10,13H,5-8H2,1-4H3.
What are the key properties of 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine?
8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine has a molecular weight of 245.37 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-heptan-4-yl-2,6-dimethylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 68840997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).