About [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid
[3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid (PubChem CID 68841048) has the molecular formula C14H19F2N3O2
and a molecular weight of 299.32 g/mol. Its IUPAC name is [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid.
Molecular Properties
| Compound Name | [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid |
| PubChem CID | 68841048 |
| Molecular Formula | C14H19F2N3O2 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid |
| SMILES | Nc1cc(NC(=O)O)ccc1NCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H19F2N3O2/c15-14(16)5-3-9(4-6-14)8-18-12-2-1-10(7-11(12)17)19-13(20)21/h1-2,7,9,18-19H,3-6,8,17H2,(H,20,21) |
| InChIKey | IVGPVNKAQOSWFZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid?
The IUPAC name of [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid (CID 68841048) is [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid.
What is the SMILES notation for [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid?
The canonical SMILES for [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid is Nc1cc(NC(=O)O)ccc1NCC1CCC(F)(F)CC1.
What is the InChIKey of [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid?
The InChIKey is IVGPVNKAQOSWFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2N3O2/c15-14(16)5-3-9(4-6-14)8-18-12-2-1-10(7-11(12)17)19-13(20)21/h1-2,7,9,18-19H,3-6,8,17H2,(H,20,21).
What are the key properties of [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid?
[3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid has a molecular weight of 299.32 g/mol, XLogP of 3.60, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-4-[(4,4-difluorocyclohexyl)methylamino]phenyl]carbamic acid is sourced from PubChem (CID 68841048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).