C42H39N5O7S2 — CID 68841191
4-(diethylamino)-4-oxo-2,3-bis[6-[(4-phenylphenyl)sulfonylamino]-2-pyridinyl]butanoic acid (PubChem CID 68841191) has the molecular formula C42H39N5O7S2 and a molecular weight of 789.94 g/mol. Its IUPAC name is 4-(diethylamino)-4-oxo-2,3-bis[6-[(4-phenylphenyl)sulfonylamino]-2-pyridinyl]butanoic acid.
| Compound Name | 4-(diethylamino)-4-oxo-2,3-bis[6-[(4-phenylphenyl)sulfonylamino]-2-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 68841191 |
| Molecular Formula | C42H39N5O7S2 |
| Molecular Weight | 789.94 g/mol |
| Exact Mass | 789.23 |
| IUPAC Name | 4-(diethylamino)-4-oxo-2,3-bis[6-[(4-phenylphenyl)sulfonylamino]-2-pyridinyl]butanoic acid |
| SMILES | CCN(CC)C(=O)C(c1cccc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)n1)C(C(=O)O)c1cccc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C42H39N5O7S2/c1-3-47(4-2)41(48)39(35-17-11-19-37(43-35)45-55(51,52)33-25-21-31(22-26-33)29-13-7-5-8-14-29)40(42(49)50)36-18-12-20-38(44-36)46-56(53,54)34-27-23-32(24-28-34)30-15-9-6-10-16-30/h5-28,39-40H,3-4H2,1-2H3,(H,43,45)(H,44,46)(H,49,50) |
| InChIKey | FGXNROQIIBXBCC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 175.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.94 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |