About 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile
1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile (PubChem CID 68841482) has the molecular formula C18H11NO3
and a molecular weight of 289.29 g/mol. Its IUPAC name is 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile.
Molecular Properties
| Compound Name | 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile |
| PubChem CID | 68841482 |
| Molecular Formula | C18H11NO3 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile |
| SMILES | N#Cc1cc2c(c3ccc(O)c(O)c13)OCc1ccccc1-2 |
| InChI | InChI=1S/C18H11NO3/c19-8-11-7-14-12-4-2-1-3-10(12)9-22-18(14)13-5-6-15(20)17(21)16(11)13/h1-7,20-21H,9H2 |
| InChIKey | LXXCQVPQZAARAO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile?
The IUPAC name of 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile (CID 68841482) is 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile.
What is the SMILES notation for 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile?
The canonical SMILES for 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile is N#Cc1cc2c(c3ccc(O)c(O)c13)OCc1ccccc1-2.
What is the InChIKey of 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile?
The InChIKey is LXXCQVPQZAARAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NO3/c19-8-11-7-14-12-4-2-1-3-10(12)9-22-18(14)13-5-6-15(20)17(21)16(11)13/h1-7,20-21H,9H2.
What are the key properties of 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile?
1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile has a molecular weight of 289.29 g/mol, XLogP of 3.68, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroxy-6H-naphtho[1,2-c]isochromene-12-carbonitrile is sourced from PubChem (CID 68841482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).