C17H26ClN3O2 — CID 68841576
(2S)-4-[(4-amino-2-chlorophenyl)methyl]-1-tert-butyl-2-methylpiperazin-1-ium-1-carboxylate (PubChem CID 68841576) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is (2S)-4-[(4-amino-2-chlorophenyl)methyl]-1-tert-butyl-2-methylpiperazin-1-ium-1-carboxylate.
| Compound Name | (2S)-4-[(4-amino-2-chlorophenyl)methyl]-1-tert-butyl-2-methylpiperazin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 68841576 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2S)-4-[(4-amino-2-chlorophenyl)methyl]-1-tert-butyl-2-methylpiperazin-1-ium-1-carboxylate |
| SMILES | C[C@H]1CN(Cc2ccc(N)cc2Cl)CC[N+]1(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C17H26ClN3O2/c1-12-10-20(11-13-5-6-14(19)9-15(13)18)7-8-21(12,16(22)23)17(2,3)4/h5-6,9,12H,7-8,10-11,19H2,1-4H3/t12-,21?/m0/s1 |
| InChIKey | OSEOQXVDXUNYKV-SXWUCCAISA-N |
| XLogP | 2.08 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|