C21H21F3IN3O6 — CID 68842213
2-[[4-hydroxy-1-(1-iodocyclohexyl)-2,6-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]pyrimidine-5-carbonyl]amino]acetic acid (PubChem CID 68842213) has the molecular formula C21H21F3IN3O6 and a molecular weight of 595.31 g/mol. Its IUPAC name is 2-[[4-hydroxy-1-(1-iodocyclohexyl)-2,6-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]pyrimidine-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-hydroxy-1-(1-iodocyclohexyl)-2,6-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]pyrimidine-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 68842213 |
| Molecular Formula | C21H21F3IN3O6 |
| Molecular Weight | 595.31 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | 2-[[4-hydroxy-1-(1-iodocyclohexyl)-2,6-dioxo-3-[[4-(trifluoromethyl)phenyl]methyl]pyrimidine-5-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1c(O)n(Cc2ccc(C(F)(F)F)cc2)c(=O)n(C2(I)CCCCC2)c1=O |
| InChI | InChI=1S/C21H21F3IN3O6/c22-21(23,24)13-6-4-12(5-7-13)11-27-17(32)15(16(31)26-10-14(29)30)18(33)28(19(27)34)20(25)8-2-1-3-9-20/h4-7,32H,1-3,8-11H2,(H,26,31)(H,29,30) |
| InChIKey | RUMBCRSFAYDWOV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|