About 4-(aminomethyl)-1,2-oxazole-3-carboxamide
4-(aminomethyl)-1,2-oxazole-3-carboxamide (PubChem CID 68842774) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is 4-(aminomethyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-(aminomethyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 68842774 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 4-(aminomethyl)-1,2-oxazole-3-carboxamide |
| SMILES | NCc1conc1C(N)=O |
| InChI | InChI=1S/C5H7N3O2/c6-1-3-2-10-8-4(3)5(7)9/h2H,1,6H2,(H2,7,9) |
| InChIKey | OYVVJROOYCCKRR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 4-(aminomethyl)-1,2-oxazole-3-carboxamide (CID 68842774) is 4-(aminomethyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 4-(aminomethyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 4-(aminomethyl)-1,2-oxazole-3-carboxamide is NCc1conc1C(N)=O.
What is the InChIKey of 4-(aminomethyl)-1,2-oxazole-3-carboxamide?
The InChIKey is OYVVJROOYCCKRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c6-1-3-2-10-8-4(3)5(7)9/h2H,1,6H2,(H2,7,9).
What are the key properties of 4-(aminomethyl)-1,2-oxazole-3-carboxamide?
4-(aminomethyl)-1,2-oxazole-3-carboxamide has a molecular weight of 141.13 g/mol, XLogP of -0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 68842774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).