C7H8F3N3O4 — CID 68842776
N-(aminomethyl)-1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 68842776) has the molecular formula C7H8F3N3O4 and a molecular weight of 255.15 g/mol. Its IUPAC name is N-(aminomethyl)-1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(aminomethyl)-1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68842776 |
| Molecular Formula | C7H8F3N3O4 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | N-(aminomethyl)-1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NCNC(=O)c1ccon1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H7N3O2.C2HF3O2/c6-3-7-5(9)4-1-2-10-8-4;3-2(4,5)1(6)7/h1-2H,3,6H2,(H,7,9);(H,6,7) |
| InChIKey | WKANQBILSZHIEG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|