C16H22ClN3O5S — CID 68842847
(2S)-2-[(3-chloro-2,5-dimethyl-3,4-dihydropyrazol-4-yl)sulfonylamino]-2-[(4-hydroxyphenyl)methyl]butanoic acid (PubChem CID 68842847) has the molecular formula C16H22ClN3O5S and a molecular weight of 403.89 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-2,5-dimethyl-3,4-dihydropyrazol-4-yl)sulfonylamino]-2-[(4-hydroxyphenyl)methyl]butanoic acid.
| Compound Name | (2S)-2-[(3-chloro-2,5-dimethyl-3,4-dihydropyrazol-4-yl)sulfonylamino]-2-[(4-hydroxyphenyl)methyl]butanoic acid |
|---|---|
| PubChem CID | 68842847 |
| Molecular Formula | C16H22ClN3O5S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (2S)-2-[(3-chloro-2,5-dimethyl-3,4-dihydropyrazol-4-yl)sulfonylamino]-2-[(4-hydroxyphenyl)methyl]butanoic acid |
| SMILES | CC[C@@](Cc1ccc(O)cc1)(NS(=O)(=O)C1C(C)=NN(C)C1Cl)C(=O)O |
| InChI | InChI=1S/C16H22ClN3O5S/c1-4-16(15(22)23,9-11-5-7-12(21)8-6-11)19-26(24,25)13-10(2)18-20(3)14(13)17/h5-8,13-14,19,21H,4,9H2,1-3H3,(H,22,23)/t13?,14?,16-/m0/s1 |
| InChIKey | JTSTTXISLKVQPK-XUJLQICISA-N |
| XLogP | 1.34 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|