About ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate
ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 68843307) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate.
Molecular Properties
| Compound Name | ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate |
| PubChem CID | 68843307 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1OCC=C[C@H]1O |
| InChI | InChI=1S/C8H12O4/c1-2-11-8(10)7-6(9)4-3-5-12-7/h3-4,6-7,9H,2,5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | TUEGYHRLGIKHAL-RQJHMYQMSA-N |
| XLogP | -0.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate?
The IUPAC name of ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate (CID 68843307) is ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate.
What is the SMILES notation for ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate?
The canonical SMILES for ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate is CCOC(=O)[C@H]1OCC=C[C@H]1O.
What is the InChIKey of ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate?
The InChIKey is TUEGYHRLGIKHAL-RQJHMYQMSA-N. The full InChI is InChI=1S/C8H12O4/c1-2-11-8(10)7-6(9)4-3-5-12-7/h3-4,6-7,9H,2,5H2,1H3/t6-,7+/m1/s1.
What are the key properties of ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate?
ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate has a molecular weight of 172.18 g/mol, XLogP of -0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S,3R)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate is sourced from PubChem (CID 68843307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).