C29H33F2N3O4S — CID 68843631
(3R,6R)-1-[(1R)-1-(2,4-difluorophenyl)-2-oxo-2-(1-oxo-1,4-thiazinan-4-yl)ethyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione (PubChem CID 68843631) has the molecular formula C29H33F2N3O4S and a molecular weight of 557.66 g/mol. Its IUPAC name is (3R,6R)-1-[(1R)-1-(2,4-difluorophenyl)-2-oxo-2-(1-oxo-1,4-thiazinan-4-yl)ethyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione.
| Compound Name | (3R,6R)-1-[(1R)-1-(2,4-difluorophenyl)-2-oxo-2-(1-oxo-1,4-thiazinan-4-yl)ethyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 68843631 |
| Molecular Formula | C29H33F2N3O4S |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (3R,6R)-1-[(1R)-1-(2,4-difluorophenyl)-2-oxo-2-(1-oxo-1,4-thiazinan-4-yl)ethyl]-3-(2,3-dihydro-1H-inden-2-yl)-6-(2-methylpropyl)piperazine-2,5-dione |
| SMILES | CC(C)C[C@@H]1C(=O)N[C@H](C2Cc3ccccc3C2)C(=O)N1[C@@H](C(=O)N1CCS(=O)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C29H33F2N3O4S/c1-17(2)13-24-27(35)32-25(20-14-18-5-3-4-6-19(18)15-20)28(36)34(24)26(22-8-7-21(30)16-23(22)31)29(37)33-9-11-39(38)12-10-33/h3-8,16-17,20,24-26H,9-15H2,1-2H3,(H,32,35)/t24-,25-,26-/m1/s1 |
| InChIKey | INVGJCCESVWTMX-TWJOJJKGSA-N |
| XLogP | 2.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |