About manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene)
manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene) (PubChem CID 68843946) has the molecular formula C16H22Mn
and a molecular weight of 269.29 g/mol. Its IUPAC name is manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene).
Molecular Properties
| Compound Name | manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene) |
| PubChem CID | 68843946 |
| Molecular Formula | C16H22Mn |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene) |
| SMILES | CC(C)C1=[C-]CC=C1.CC(C)C1=[C-]CC=C1.[Mn+2] |
| InChI | InChI=1S/2C8H11.Mn/c2*1-7(2)8-5-3-4-6-8;/h2*3,5,7H,4H2,1-2H3;/q2*-1;+2 |
| InChIKey | GPEICPBNERHSCM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene)?
The IUPAC name of manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene) (CID 68843946) is manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene).
What is the SMILES notation for manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene)?
The canonical SMILES for manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene) is CC(C)C1=[C-]CC=C1.CC(C)C1=[C-]CC=C1.[Mn+2].
What is the InChIKey of manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene)?
The InChIKey is GPEICPBNERHSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H11.Mn/c2*1-7(2)8-5-3-4-6-8;/h2*3,5,7H,4H2,1-2H3;/q2*-1;+2.
What are the key properties of manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene)?
manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene) has a molecular weight of 269.29 g/mol, XLogP of 4.66, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);bis(2-propan-2-ylcyclopenta-1,3-diene) is sourced from PubChem (CID 68843946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).