C29H35N5O5S — CID 68844534
1-[4-[4-[1-(benzenesulfonyl)cyclopropyl]-6-[(3S)-3-ethylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-(2-hydroxypropan-2-yl)urea (PubChem CID 68844534) has the molecular formula C29H35N5O5S and a molecular weight of 565.70 g/mol. Its IUPAC name is 1-[4-[4-[1-(benzenesulfonyl)cyclopropyl]-6-[(3S)-3-ethylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-(2-hydroxypropan-2-yl)urea.
| Compound Name | 1-[4-[4-[1-(benzenesulfonyl)cyclopropyl]-6-[(3S)-3-ethylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-(2-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 68844534 |
| Molecular Formula | C29H35N5O5S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 1-[4-[4-[1-(benzenesulfonyl)cyclopropyl]-6-[(3S)-3-ethylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-(2-hydroxypropan-2-yl)urea |
| SMILES | CC[C@H]1COCCN1c1cc(C2(S(=O)(=O)c3ccccc3)CC2)nc(-c2ccc(NC(=O)NC(C)(C)O)cc2)n1 |
| InChI | InChI=1S/C29H35N5O5S/c1-4-22-19-39-17-16-34(22)25-18-24(29(14-15-29)40(37,38)23-8-6-5-7-9-23)31-26(32-25)20-10-12-21(13-11-20)30-27(35)33-28(2,3)36/h5-13,18,22,36H,4,14-17,19H2,1-3H3,(H2,30,33,35)/t22-/m0/s1 |
| InChIKey | CADAXDIDOFCQIW-QFIPXVFZSA-N |
| XLogP | 4.07 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|